C25H39NO6 — CID 10694817
triethyl (2E,9E)-4-cyano-3-ethyl-11-methyldodeca-2,9-diene-3,7,7-tricarboxylate (PubChem CID 10694817) has the molecular formula C25H39NO6 and a molecular weight of 449.59 g/mol. Its IUPAC name is triethyl (2E,9E)-4-cyano-3-ethyl-11-methyldodeca-2,9-diene-3,7,7-tricarboxylate.
| Compound Name | triethyl (2E,9E)-4-cyano-3-ethyl-11-methyldodeca-2,9-diene-3,7,7-tricarboxylate |
|---|---|
| PubChem CID | 10694817 |
| Molecular Formula | C25H39NO6 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | triethyl (2E,9E)-4-cyano-3-ethyl-11-methyldodeca-2,9-diene-3,7,7-tricarboxylate |
| SMILES | C/C=C(\CC)C(C#N)(CCCC(/C=C/C(C)C)(C(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C25H39NO6/c1-8-20(9-2)25(18-26,23(29)32-12-5)16-13-15-24(17-14-19(6)7,21(27)30-10-3)22(28)31-11-4/h8,14,17,19H,9-13,15-16H2,1-7H3/b17-14+,20-8+ |
| InChIKey | HSHXBWJLFLJNMI-CMZBJQQSSA-N |
| XLogP | 4.91 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|