C14H22BrNO2 — CID 10567388
ethyl (2S,5S)-5-bromo-2-cyano-2-[(E)-pent-2-en-3-yl]hexanoate (PubChem CID 10567388) has the molecular formula C14H22BrNO2 and a molecular weight of 316.24 g/mol. Its IUPAC name is ethyl (2S,5S)-5-bromo-2-cyano-2-[(E)-pent-2-en-3-yl]hexanoate.
| Compound Name | ethyl (2S,5S)-5-bromo-2-cyano-2-[(E)-pent-2-en-3-yl]hexanoate |
|---|---|
| PubChem CID | 10567388 |
| Molecular Formula | C14H22BrNO2 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | ethyl (2S,5S)-5-bromo-2-cyano-2-[(E)-pent-2-en-3-yl]hexanoate |
| SMILES | C/C=C(\CC)[C@](C#N)(CC[C@H](C)Br)C(=O)OCC |
| InChI | InChI=1S/C14H22BrNO2/c1-5-12(6-2)14(10-16,9-8-11(4)15)13(17)18-7-3/h5,11H,6-9H2,1-4H3/b12-5+/t11-,14+/m0/s1 |
| InChIKey | JKMIFDWMUBEKHF-NSMGERTKSA-N |
| XLogP | 3.98 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|