C15H18N2O4 — CID 13134701
7-O-ethyl 1-O-methyl (2Z,4E)-6-cyano-6-(cyanomethyl)-2,5-dimethylhepta-2,4-dienedioate (PubChem CID 13134701) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 7-O-ethyl 1-O-methyl (2Z,4E)-6-cyano-6-(cyanomethyl)-2,5-dimethylhepta-2,4-dienedioate.
| Compound Name | 7-O-ethyl 1-O-methyl (2Z,4E)-6-cyano-6-(cyanomethyl)-2,5-dimethylhepta-2,4-dienedioate |
|---|---|
| PubChem CID | 13134701 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 7-O-ethyl 1-O-methyl (2Z,4E)-6-cyano-6-(cyanomethyl)-2,5-dimethylhepta-2,4-dienedioate |
| SMILES | CCOC(=O)C(C#N)(CC#N)/C(C)=C/C=C(/C)C(=O)OC |
| InChI | InChI=1S/C15H18N2O4/c1-5-21-14(19)15(10-17,8-9-16)12(3)7-6-11(2)13(18)20-4/h6-7H,5,8H2,1-4H3/b11-6-,12-7+ |
| InChIKey | PORDYHLIIPJXMQ-TWTKIJFOSA-N |
| XLogP | 2.04 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|