C28H21NO5 — CID 10694890
2-[4-hydroxy-3-[(E)-3-[3-[(E)-2-quinolin-2-ylethenyl]phenyl]prop-2-enoyl]phenoxy]acetic acid (PubChem CID 10694890) has the molecular formula C28H21NO5 and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-[4-hydroxy-3-[(E)-3-[3-[(E)-2-quinolin-2-ylethenyl]phenyl]prop-2-enoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-hydroxy-3-[(E)-3-[3-[(E)-2-quinolin-2-ylethenyl]phenyl]prop-2-enoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10694890 |
| Molecular Formula | C28H21NO5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-[4-hydroxy-3-[(E)-3-[3-[(E)-2-quinolin-2-ylethenyl]phenyl]prop-2-enoyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(O)c(C(=O)/C=C/c2cccc(/C=C/c3ccc4ccccc4n3)c2)c1 |
| InChI | InChI=1S/C28H21NO5/c30-26(24-17-23(13-15-27(24)31)34-18-28(32)33)14-9-20-5-3-4-19(16-20)8-11-22-12-10-21-6-1-2-7-25(21)29-22/h1-17,31H,18H2,(H,32,33)/b11-8+,14-9+ |
| InChIKey | KKKANLNLSLPJEX-GBMJPCLJSA-N |
| XLogP | 5.47 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|