C12H14N4O2 — CID 106950041
4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)piperidin-4-ol (PubChem CID 106950041) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)piperidin-4-ol.
| Compound Name | 4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 106950041 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)piperidin-4-ol |
| SMILES | OC1(c2nc(-c3ccncc3)no2)CCNCC1 |
| InChI | InChI=1S/C12H14N4O2/c17-12(3-7-14-8-4-12)11-15-10(16-18-11)9-1-5-13-6-2-9/h1-2,5-6,14,17H,3-4,7-8H2 |
| InChIKey | QRUZEUNYHKAZLC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |