4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid

C14H15N3O3 — CID 82625991

IUPAC4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid
SMILESO=C(O)C1(c2nc(-c3ccccc3)no2)CCNCC1
InChIInChI=1S/C14H15N3O3/c18-13(19)14(6-8-15-9-7-14)12-16-11(17-20-12)10-4-2-1-3-5-10/h1-5,15H,6-9H2,(H,18,19)
InChIKeyAQPCHAUZHLFOLO-UHFFFAOYSA-N
MW273.29 g/mol
LogP1.44
Rot. Bonds3

About 4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid

4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid (PubChem CID 82625991) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid.

Molecular Properties

Compound Name4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid
PubChem CID82625991
Molecular FormulaC14H15N3O3
Molecular Weight273.29 g/mol
Exact Mass273.11
IUPAC Name4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid
SMILESO=C(O)C1(c2nc(-c3ccccc3)no2)CCNCC1
InChIInChI=1S/C14H15N3O3/c18-13(19)14(6-8-15-9-7-14)12-16-11(17-20-12)10-4-2-1-3-5-10/h1-5,15H,6-9H2,(H,18,19)
InChIKeyAQPCHAUZHLFOLO-UHFFFAOYSA-N
XLogP1.44
TPSA88.25 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.29
LogP ≤ 51.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid?
The IUPAC name of 4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid (CID 82625991) is 4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid.
What is the SMILES notation for 4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid?
The canonical SMILES for 4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid is O=C(O)C1(c2nc(-c3ccccc3)no2)CCNCC1.
What is the InChIKey of 4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid?
The InChIKey is AQPCHAUZHLFOLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O3/c18-13(19)14(6-8-15-9-7-14)12-16-11(17-20-12)10-4-2-1-3-5-10/h1-5,15H,6-9H2,(H,18,19).
What are the key properties of 4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid?
4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid has a molecular weight of 273.29 g/mol, XLogP of 1.44, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine-4-carboxylic acid is sourced from PubChem (CID 82625991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).