C13H9BrF2N2O3 — CID 106951130
2-(3-bromo-4-methoxyphenyl)-4-(difluoromethyl)pyrimidine-5-carboxylic acid (PubChem CID 106951130) has the molecular formula C13H9BrF2N2O3 and a molecular weight of 359.13 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-4-(difluoromethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-4-(difluoromethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 106951130 |
| Molecular Formula | C13H9BrF2N2O3 |
| Molecular Weight | 359.13 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-4-(difluoromethyl)pyrimidine-5-carboxylic acid |
| SMILES | COc1ccc(-c2ncc(C(=O)O)c(C(F)F)n2)cc1Br |
| InChI | InChI=1S/C13H9BrF2N2O3/c1-21-9-3-2-6(4-8(9)14)12-17-5-7(13(19)20)10(18-12)11(15)16/h2-5,11H,1H3,(H,19,20) |
| InChIKey | RMVRLVGDBPFFLF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.13 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |