C12H13ClN2O — CID 106952576
2-[(4-chlorophenyl)methyl]-4-ethyl-1,4-dihydroimidazol-5-one (PubChem CID 106952576) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-4-ethyl-1,4-dihydroimidazol-5-one.
| Compound Name | 2-[(4-chlorophenyl)methyl]-4-ethyl-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 106952576 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-4-ethyl-1,4-dihydroimidazol-5-one |
| SMILES | CCC1N=C(Cc2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C12H13ClN2O/c1-2-10-12(16)15-11(14-10)7-8-3-5-9(13)6-4-8/h3-6,10H,2,7H2,1H3,(H,14,15,16) |
| InChIKey | XWQXSWZVGHAPLA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |