C13H13ClN2O — CID 135934939
(4Z)-4-[(4-chlorophenyl)methylidene]-2-propyl-1H-imidazol-5-one (PubChem CID 135934939) has the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. Its IUPAC name is (4Z)-4-[(4-chlorophenyl)methylidene]-2-propyl-1H-imidazol-5-one.
| Compound Name | (4Z)-4-[(4-chlorophenyl)methylidene]-2-propyl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 135934939 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (4Z)-4-[(4-chlorophenyl)methylidene]-2-propyl-1H-imidazol-5-one |
| SMILES | CCCC1=N/C(=C\c2ccc(Cl)cc2)C(=O)N1 |
| InChI | InChI=1S/C13H13ClN2O/c1-2-3-12-15-11(13(17)16-12)8-9-4-6-10(14)7-5-9/h4-8H,2-3H2,1H3,(H,15,16,17)/b11-8- |
| InChIKey | HGGURLGSDMVXGJ-FLIBITNWSA-N |
| XLogP | 3.01 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|