C12H8ClF3N2O — CID 139630435
2-[(4-chlorophenyl)methyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 139630435) has the molecular formula C12H8ClF3N2O and a molecular weight of 288.66 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[(4-chlorophenyl)methyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 139630435 |
| Molecular Formula | C12H8ClF3N2O |
| Molecular Weight | 288.66 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)F)nc(Cc2ccc(Cl)cc2)[nH]1 |
| InChI | InChI=1S/C12H8ClF3N2O/c13-8-3-1-7(2-4-8)5-10-17-9(12(14,15)16)6-11(19)18-10/h1-4,6H,5H2,(H,17,18,19) |
| InChIKey | LEMBPKBGSYKWDH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.66 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |