C9H16N2O2 — CID 106952910
2-(1-methoxyethyl)-4-propyl-1,4-dihydroimidazol-5-one (PubChem CID 106952910) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-(1-methoxyethyl)-4-propyl-1,4-dihydroimidazol-5-one.
| Compound Name | 2-(1-methoxyethyl)-4-propyl-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 106952910 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 2-(1-methoxyethyl)-4-propyl-1,4-dihydroimidazol-5-one |
| SMILES | CCCC1N=C(C(C)OC)NC1=O |
| InChI | InChI=1S/C9H16N2O2/c1-4-5-7-9(12)11-8(10-7)6(2)13-3/h6-7H,4-5H2,1-3H3,(H,10,11,12) |
| InChIKey | SUSFPFMNCKTHHM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |