C12H22N2O2 — CID 106952802
2-(3-methoxypentan-3-yl)-4-propyl-1,4-dihydroimidazol-5-one (PubChem CID 106952802) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-(3-methoxypentan-3-yl)-4-propyl-1,4-dihydroimidazol-5-one.
| Compound Name | 2-(3-methoxypentan-3-yl)-4-propyl-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 106952802 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 2-(3-methoxypentan-3-yl)-4-propyl-1,4-dihydroimidazol-5-one |
| SMILES | CCCC1N=C(C(CC)(CC)OC)NC1=O |
| InChI | InChI=1S/C12H22N2O2/c1-5-8-9-10(15)14-11(13-9)12(6-2,7-3)16-4/h9H,5-8H2,1-4H3,(H,13,14,15) |
| InChIKey | PLEYTXNARUOTMT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |