C11H20N2O2 — CID 106952604
2-(2-ethoxybutan-2-yl)-4-ethyl-1,4-dihydroimidazol-5-one (PubChem CID 106952604) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-(2-ethoxybutan-2-yl)-4-ethyl-1,4-dihydroimidazol-5-one.
| Compound Name | 2-(2-ethoxybutan-2-yl)-4-ethyl-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 106952604 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-(2-ethoxybutan-2-yl)-4-ethyl-1,4-dihydroimidazol-5-one |
| SMILES | CCOC(C)(CC)C1=NC(CC)C(=O)N1 |
| InChI | InChI=1S/C11H20N2O2/c1-5-8-9(14)13-10(12-8)11(4,6-2)15-7-3/h8H,5-7H2,1-4H3,(H,12,13,14) |
| InChIKey | SLOSHBMQLFKTNU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |