C11H18N2O3 — CID 106952717
4-ethyl-2-(4-methoxyoxan-4-yl)-1,4-dihydroimidazol-5-one (PubChem CID 106952717) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-ethyl-2-(4-methoxyoxan-4-yl)-1,4-dihydroimidazol-5-one.
| Compound Name | 4-ethyl-2-(4-methoxyoxan-4-yl)-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 106952717 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 4-ethyl-2-(4-methoxyoxan-4-yl)-1,4-dihydroimidazol-5-one |
| SMILES | CCC1N=C(C2(OC)CCOCC2)NC1=O |
| InChI | InChI=1S/C11H18N2O3/c1-3-8-9(14)13-10(12-8)11(15-2)4-6-16-7-5-11/h8H,3-7H2,1-2H3,(H,12,13,14) |
| InChIKey | ZBNAEDOZOXVNJL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |