C13H19IN2O3 — CID 136964011
5-iodo-2-(4-methoxyoxan-4-yl)-4-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 136964011) has the molecular formula C13H19IN2O3 and a molecular weight of 378.21 g/mol. Its IUPAC name is 5-iodo-2-(4-methoxyoxan-4-yl)-4-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-2-(4-methoxyoxan-4-yl)-4-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136964011 |
| Molecular Formula | C13H19IN2O3 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 5-iodo-2-(4-methoxyoxan-4-yl)-4-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | COC1(c2nc(C(C)C)c(I)c(=O)[nH]2)CCOCC1 |
| InChI | InChI=1S/C13H19IN2O3/c1-8(2)10-9(14)11(17)16-12(15-10)13(18-3)4-6-19-7-5-13/h8H,4-7H2,1-3H3,(H,15,16,17) |
| InChIKey | TXZZGJDNBLQVJS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|