C12H17N3O5 — CID 136964595
2-[4-amino-2-(4-methoxyoxan-4-yl)-6-oxo-1H-pyrimidin-5-yl]acetic acid (PubChem CID 136964595) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-[4-amino-2-(4-methoxyoxan-4-yl)-6-oxo-1H-pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[4-amino-2-(4-methoxyoxan-4-yl)-6-oxo-1H-pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136964595 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-[4-amino-2-(4-methoxyoxan-4-yl)-6-oxo-1H-pyrimidin-5-yl]acetic acid |
| SMILES | COC1(c2nc(N)c(CC(=O)O)c(=O)[nH]2)CCOCC1 |
| InChI | InChI=1S/C12H17N3O5/c1-19-12(2-4-20-5-3-12)11-14-9(13)7(6-8(16)17)10(18)15-11/h2-6H2,1H3,(H,16,17)(H3,13,14,15,18) |
| InChIKey | DTOAEVXROCHCBI-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |