C13H21N3O4 — CID 136964594
2-[4-amino-2-(3-ethoxypentan-3-yl)-6-oxo-1H-pyrimidin-5-yl]acetic acid (PubChem CID 136964594) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[4-amino-2-(3-ethoxypentan-3-yl)-6-oxo-1H-pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[4-amino-2-(3-ethoxypentan-3-yl)-6-oxo-1H-pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136964594 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[4-amino-2-(3-ethoxypentan-3-yl)-6-oxo-1H-pyrimidin-5-yl]acetic acid |
| SMILES | CCOC(CC)(CC)c1nc(N)c(CC(=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C13H21N3O4/c1-4-13(5-2,20-6-3)12-15-10(14)8(7-9(17)18)11(19)16-12/h4-7H2,1-3H3,(H,17,18)(H3,14,15,16,19) |
| InChIKey | DZJGTQNVEKRDNO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |