2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid

C7H10N4O2 — CID 45071760

IUPAC2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid
SMILESCc1nc(N)nc(N)c1CC(=O)O
InChIInChI=1S/C7H10N4O2/c1-3-4(2-5(12)13)6(8)11-7(9)10-3/h2H2,1H3,(H,12,13)(H4,8,9,10,11)
InChIKeyPAWTWNJXYYKAHG-UHFFFAOYSA-N
MW182.18 g/mol
LogP-0.42
Rot. Bonds2

About 2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid

2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid (PubChem CID 45071760) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid
PubChem CID45071760
Molecular FormulaC7H10N4O2
Molecular Weight182.18 g/mol
Exact Mass182.08
IUPAC Name2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid
SMILESCc1nc(N)nc(N)c1CC(=O)O
InChIInChI=1S/C7H10N4O2/c1-3-4(2-5(12)13)6(8)11-7(9)10-3/h2H2,1H3,(H,12,13)(H4,8,9,10,11)
InChIKeyPAWTWNJXYYKAHG-UHFFFAOYSA-N
XLogP-0.42
TPSA115.12 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.18
LogP ≤ 5-0.42
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid?
The IUPAC name of 2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid (CID 45071760) is 2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid.
What is the SMILES notation for 2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid?
The canonical SMILES for 2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid is Cc1nc(N)nc(N)c1CC(=O)O.
What is the InChIKey of 2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid?
The InChIKey is PAWTWNJXYYKAHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c1-3-4(2-5(12)13)6(8)11-7(9)10-3/h2H2,1H3,(H,12,13)(H4,8,9,10,11).
What are the key properties of 2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid?
2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid has a molecular weight of 182.18 g/mol, XLogP of -0.42, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-diamino-6-methylpyrimidin-5-yl)acetic acid is sourced from PubChem (CID 45071760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).