2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid

C6H7ClN4O2 — CID 83869056

IUPAC2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid
SMILESNc1nc(N)c(Cl)c(CC(=O)O)n1
InChIInChI=1S/C6H7ClN4O2/c7-4-2(1-3(12)13)10-6(9)11-5(4)8/h1H2,(H,12,13)(H4,8,9,10,11)
InChIKeyJPXZYCRHPOGGRA-UHFFFAOYSA-N
MW202.60 g/mol
LogP-0.08
Rot. Bonds2

About 2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid

2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid (PubChem CID 83869056) has the molecular formula C6H7ClN4O2 and a molecular weight of 202.60 g/mol. Its IUPAC name is 2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid.

Molecular Properties

Compound Name2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid
PubChem CID83869056
Molecular FormulaC6H7ClN4O2
Molecular Weight202.60 g/mol
Exact Mass202.03
IUPAC Name2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid
SMILESNc1nc(N)c(Cl)c(CC(=O)O)n1
InChIInChI=1S/C6H7ClN4O2/c7-4-2(1-3(12)13)10-6(9)11-5(4)8/h1H2,(H,12,13)(H4,8,9,10,11)
InChIKeyJPXZYCRHPOGGRA-UHFFFAOYSA-N
XLogP-0.08
TPSA115.12 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.60
LogP ≤ 5-0.08
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid?
The IUPAC name of 2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid (CID 83869056) is 2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid.
What is the SMILES notation for 2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid?
The canonical SMILES for 2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid is Nc1nc(N)c(Cl)c(CC(=O)O)n1.
What is the InChIKey of 2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid?
The InChIKey is JPXZYCRHPOGGRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN4O2/c7-4-2(1-3(12)13)10-6(9)11-5(4)8/h1H2,(H,12,13)(H4,8,9,10,11).
What are the key properties of 2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid?
2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid has a molecular weight of 202.60 g/mol, XLogP of -0.08, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-diamino-5-chloropyrimidin-4-yl)acetic acid is sourced from PubChem (CID 83869056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).