C12H19N3O4 — CID 136965149
2-[4-amino-2-(1-ethoxy-2-methylpropyl)-6-oxo-1H-pyrimidin-5-yl]acetic acid (PubChem CID 136965149) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[4-amino-2-(1-ethoxy-2-methylpropyl)-6-oxo-1H-pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[4-amino-2-(1-ethoxy-2-methylpropyl)-6-oxo-1H-pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136965149 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[4-amino-2-(1-ethoxy-2-methylpropyl)-6-oxo-1H-pyrimidin-5-yl]acetic acid |
| SMILES | CCOC(c1nc(N)c(CC(=O)O)c(=O)[nH]1)C(C)C |
| InChI | InChI=1S/C12H19N3O4/c1-4-19-9(6(2)3)11-14-10(13)7(5-8(16)17)12(18)15-11/h6,9H,4-5H2,1-3H3,(H,16,17)(H3,13,14,15,18) |
| InChIKey | APMDWPVLISBIBK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |