C7H12N2O2 — CID 142558595
(5R)-5-ethyl-3-methoxy-2,5-dihydro-1H-pyrazin-6-one (PubChem CID 142558595) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is (5R)-5-ethyl-3-methoxy-2,5-dihydro-1H-pyrazin-6-one.
| Compound Name | (5R)-5-ethyl-3-methoxy-2,5-dihydro-1H-pyrazin-6-one |
|---|---|
| PubChem CID | 142558595 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (5R)-5-ethyl-3-methoxy-2,5-dihydro-1H-pyrazin-6-one |
| SMILES | CC[C@H]1N=C(OC)CNC1=O |
| InChI | InChI=1S/C7H12N2O2/c1-3-5-7(10)8-4-6(9-5)11-2/h5H,3-4H2,1-2H3,(H,8,10)/t5-/m1/s1 |
| InChIKey | ODZDFEMTEFQYSU-RXMQYKEDSA-N |
| XLogP | -0.06 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |