C13H22N2O2 — CID 106953233
2-[cyclohexyl(methoxy)methyl]-4,4-dimethyl-1H-imidazol-5-one (PubChem CID 106953233) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-[cyclohexyl(methoxy)methyl]-4,4-dimethyl-1H-imidazol-5-one.
| Compound Name | 2-[cyclohexyl(methoxy)methyl]-4,4-dimethyl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 106953233 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-[cyclohexyl(methoxy)methyl]-4,4-dimethyl-1H-imidazol-5-one |
| SMILES | COC(C1=NC(C)(C)C(=O)N1)C1CCCCC1 |
| InChI | InChI=1S/C13H22N2O2/c1-13(2)12(16)14-11(15-13)10(17-3)9-7-5-4-6-8-9/h9-10H,4-8H2,1-3H3,(H,14,15,16) |
| InChIKey | ZUGLXSGKSLHJGE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |