About 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol
4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol (PubChem CID 106953853) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol |
| PubChem CID | 106953853 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol |
| SMILES | CCC1CCCC(Nc2cc(C)c(O)cc2C)CC1 |
| InChI | InChI=1S/C17H27NO/c1-4-14-6-5-7-15(9-8-14)18-16-10-13(3)17(19)11-12(16)2/h10-11,14-15,18-19H,4-9H2,1-3H3 |
| InChIKey | VQHOBGURDMHEME-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol?
The IUPAC name of 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol (CID 106953853) is 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol.
What is the SMILES notation for 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol?
The canonical SMILES for 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol is CCC1CCCC(Nc2cc(C)c(O)cc2C)CC1.
What is the InChIKey of 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol?
The InChIKey is VQHOBGURDMHEME-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO/c1-4-14-6-5-7-15(9-8-14)18-16-10-13(3)17(19)11-12(16)2/h10-11,14-15,18-19H,4-9H2,1-3H3.
What are the key properties of 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol?
4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol has a molecular weight of 261.41 g/mol, XLogP of 4.78, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-ethylcycloheptyl)amino]-2,5-dimethylphenol is sourced from PubChem (CID 106953853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).