C17H27NO — CID 106954098
2,5-dimethyl-4-[(4-propylcyclohexyl)amino]phenol (PubChem CID 106954098) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 2,5-dimethyl-4-[(4-propylcyclohexyl)amino]phenol.
| Compound Name | 2,5-dimethyl-4-[(4-propylcyclohexyl)amino]phenol |
|---|---|
| PubChem CID | 106954098 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 2,5-dimethyl-4-[(4-propylcyclohexyl)amino]phenol |
| SMILES | CCCC1CCC(Nc2cc(C)c(O)cc2C)CC1 |
| InChI | InChI=1S/C17H27NO/c1-4-5-14-6-8-15(9-7-14)18-16-10-13(3)17(19)11-12(16)2/h10-11,14-15,18-19H,4-9H2,1-3H3 |
| InChIKey | DRQRRFPBTIAGEV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|