C16H25N3O2 — CID 106954484
N-(4-hydroxy-2,5-dimethylphenyl)-2-methyl-2-piperazin-1-ylpropanamide (PubChem CID 106954484) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is N-(4-hydroxy-2,5-dimethylphenyl)-2-methyl-2-piperazin-1-ylpropanamide.
| Compound Name | N-(4-hydroxy-2,5-dimethylphenyl)-2-methyl-2-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 106954484 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-(4-hydroxy-2,5-dimethylphenyl)-2-methyl-2-piperazin-1-ylpropanamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)N2CCNCC2)c(C)cc1O |
| InChI | InChI=1S/C16H25N3O2/c1-11-10-14(20)12(2)9-13(11)18-15(21)16(3,4)19-7-5-17-6-8-19/h9-10,17,20H,5-8H2,1-4H3,(H,18,21) |
| InChIKey | KHSLRAXNQMKBJL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|