C14H18F3N3O — CID 80550540
2-methyl-2-piperazin-1-yl-N-(2,4,6-trifluorophenyl)propanamide (PubChem CID 80550540) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-methyl-2-piperazin-1-yl-N-(2,4,6-trifluorophenyl)propanamide.
| Compound Name | 2-methyl-2-piperazin-1-yl-N-(2,4,6-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 80550540 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-methyl-2-piperazin-1-yl-N-(2,4,6-trifluorophenyl)propanamide |
| SMILES | CC(C)(C(=O)Nc1c(F)cc(F)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C14H18F3N3O/c1-14(2,20-5-3-18-4-6-20)13(21)19-12-10(16)7-9(15)8-11(12)17/h7-8,18H,3-6H2,1-2H3,(H,19,21) |
| InChIKey | JCKOERSAHGEBON-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |