C14H18N4O2 — CID 106954626
N-(4-hydroxy-2,5-dimethylphenyl)-5-propan-2-yl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 106954626) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-(4-hydroxy-2,5-dimethylphenyl)-5-propan-2-yl-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(4-hydroxy-2,5-dimethylphenyl)-5-propan-2-yl-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 106954626 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-(4-hydroxy-2,5-dimethylphenyl)-5-propan-2-yl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2n[nH]c(C(C)C)n2)c(C)cc1O |
| InChI | InChI=1S/C14H18N4O2/c1-7(2)12-16-13(18-17-12)14(20)15-10-5-9(4)11(19)6-8(10)3/h5-7,19H,1-4H3,(H,15,20)(H,16,17,18) |
| InChIKey | IQORECVXQHYBSZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|