C14H18N4O3 — CID 106955064
methyl 4-amino-2-[(2-propyl-1,2,4-triazol-3-yl)methoxy]benzoate (PubChem CID 106955064) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl 4-amino-2-[(2-propyl-1,2,4-triazol-3-yl)methoxy]benzoate.
| Compound Name | methyl 4-amino-2-[(2-propyl-1,2,4-triazol-3-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 106955064 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | methyl 4-amino-2-[(2-propyl-1,2,4-triazol-3-yl)methoxy]benzoate |
| SMILES | CCCn1ncnc1COc1cc(N)ccc1C(=O)OC |
| InChI | InChI=1S/C14H18N4O3/c1-3-6-18-13(16-9-17-18)8-21-12-7-10(15)4-5-11(12)14(19)20-2/h4-5,7,9H,3,6,8,15H2,1-2H3 |
| InChIKey | BAFRVEGSLBCPTI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|