C15H20N4O3 — CID 122155317
ethyl N-[4-[(2-propyl-1,2,4-triazol-3-yl)methoxy]phenyl]carbamate (PubChem CID 122155317) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is ethyl N-[4-[(2-propyl-1,2,4-triazol-3-yl)methoxy]phenyl]carbamate.
| Compound Name | ethyl N-[4-[(2-propyl-1,2,4-triazol-3-yl)methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 122155317 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | ethyl N-[4-[(2-propyl-1,2,4-triazol-3-yl)methoxy]phenyl]carbamate |
| SMILES | CCCn1ncnc1COc1ccc(NC(=O)OCC)cc1 |
| InChI | InChI=1S/C15H20N4O3/c1-3-9-19-14(16-11-17-19)10-22-13-7-5-12(6-8-13)18-15(20)21-4-2/h5-8,11H,3-4,9-10H2,1-2H3,(H,18,20) |
| InChIKey | JAIAPSZGORMEIP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |