C10H12ClN3O2 — CID 106956954
5-(chloromethyl)-N-[1-(furan-2-yl)propan-2-yl]-1,3,4-oxadiazol-2-amine (PubChem CID 106956954) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is 5-(chloromethyl)-N-[1-(furan-2-yl)propan-2-yl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(chloromethyl)-N-[1-(furan-2-yl)propan-2-yl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106956954 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 5-(chloromethyl)-N-[1-(furan-2-yl)propan-2-yl]-1,3,4-oxadiazol-2-amine |
| SMILES | CC(Cc1ccco1)Nc1nnc(CCl)o1 |
| InChI | InChI=1S/C10H12ClN3O2/c1-7(5-8-3-2-4-15-8)12-10-14-13-9(6-11)16-10/h2-4,7H,5-6H2,1H3,(H,12,14) |
| InChIKey | SOZBCGSDJFHTNZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|