C15H28N4O2 — CID 106961108
N-[[5-(4,4-diethylpiperidin-1-yl)-1,3,4-oxadiazol-2-yl]methyl]-2-methoxyethanamine (PubChem CID 106961108) has the molecular formula C15H28N4O2 and a molecular weight of 296.42 g/mol. Its IUPAC name is N-[[5-(4,4-diethylpiperidin-1-yl)-1,3,4-oxadiazol-2-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-(4,4-diethylpiperidin-1-yl)-1,3,4-oxadiazol-2-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 106961108 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | N-[[5-(4,4-diethylpiperidin-1-yl)-1,3,4-oxadiazol-2-yl]methyl]-2-methoxyethanamine |
| SMILES | CCC1(CC)CCN(c2nnc(CNCCOC)o2)CC1 |
| InChI | InChI=1S/C15H28N4O2/c1-4-15(5-2)6-9-19(10-7-15)14-18-17-13(21-14)12-16-8-11-20-3/h16H,4-12H2,1-3H3 |
| InChIKey | JSRQHEJSBIWMAB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|