C23H24F5NO3S — CID 10696384
2,2,3,3,3-pentafluoropropyl 6-ethyl-5-ethylsulfanylcarbonyl-2-phenyl-4-propylpyridine-3-carboxylate (PubChem CID 10696384) has the molecular formula C23H24F5NO3S and a molecular weight of 489.51 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 6-ethyl-5-ethylsulfanylcarbonyl-2-phenyl-4-propylpyridine-3-carboxylate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 6-ethyl-5-ethylsulfanylcarbonyl-2-phenyl-4-propylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 10696384 |
| Molecular Formula | C23H24F5NO3S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 6-ethyl-5-ethylsulfanylcarbonyl-2-phenyl-4-propylpyridine-3-carboxylate |
| SMILES | CCCc1c(C(=O)SCC)c(CC)nc(-c2ccccc2)c1C(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H24F5NO3S/c1-4-10-15-17(21(31)33-6-3)16(5-2)29-19(14-11-8-7-9-12-14)18(15)20(30)32-13-22(24,25)23(26,27)28/h7-9,11-12H,4-6,10,13H2,1-3H3 |
| InChIKey | CFXTXARKEUSPHR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|