C13H5ClF3NOS2 — CID 106971859
[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-thieno[3,2-b]thiophen-5-ylmethanone (PubChem CID 106971859) has the molecular formula C13H5ClF3NOS2 and a molecular weight of 347.77 g/mol. Its IUPAC name is [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-thieno[3,2-b]thiophen-5-ylmethanone.
| Compound Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-thieno[3,2-b]thiophen-5-ylmethanone |
|---|---|
| PubChem CID | 106971859 |
| Molecular Formula | C13H5ClF3NOS2 |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-thieno[3,2-b]thiophen-5-ylmethanone |
| SMILES | O=C(c1cc2sccc2s1)c1ccc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C13H5ClF3NOS2/c14-12-6(1-2-10(18-12)13(15,16)17)11(19)9-5-8-7(21-9)3-4-20-8/h1-5H |
| InChIKey | HFDSYWYKDZXHRK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|