C13H5ClF2OS2 — CID 107475859
(2-chloro-4,5-difluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanone (PubChem CID 107475859) has the molecular formula C13H5ClF2OS2 and a molecular weight of 314.77 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanone |
|---|---|
| PubChem CID | 107475859 |
| Molecular Formula | C13H5ClF2OS2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 313.94 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanone |
| SMILES | O=C(c1cc2sccc2s1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H5ClF2OS2/c14-7-4-9(16)8(15)3-6(7)13(17)12-5-11-10(19-12)1-2-18-11/h1-5H |
| InChIKey | JSOUASKZLZFMJS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|