C10H13N3O2S — CID 106972190
2-[cyclopropyl-(6-methylsulfanylpyrimidin-4-yl)amino]acetic acid (PubChem CID 106972190) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-[cyclopropyl-(6-methylsulfanylpyrimidin-4-yl)amino]acetic acid.
| Compound Name | 2-[cyclopropyl-(6-methylsulfanylpyrimidin-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 106972190 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-[cyclopropyl-(6-methylsulfanylpyrimidin-4-yl)amino]acetic acid |
| SMILES | CSc1cc(N(CC(=O)O)C2CC2)ncn1 |
| InChI | InChI=1S/C10H13N3O2S/c1-16-9-4-8(11-6-12-9)13(5-10(14)15)7-2-3-7/h4,6-7H,2-3,5H2,1H3,(H,14,15) |
| InChIKey | PRIOONRPTUXSCI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |