C14H24N4S — CID 106973266
N-[2-(aminomethyl)cyclohexyl]-N-ethyl-6-methylsulfanylpyrimidin-4-amine (PubChem CID 106973266) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-N-ethyl-6-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-N-ethyl-6-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106973266 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-N-ethyl-6-methylsulfanylpyrimidin-4-amine |
| SMILES | CCN(c1cc(SC)ncn1)C1CCCCC1CN |
| InChI | InChI=1S/C14H24N4S/c1-3-18(12-7-5-4-6-11(12)9-15)13-8-14(19-2)17-10-16-13/h8,10-12H,3-7,9,15H2,1-2H3 |
| InChIKey | WXEYDIMXOSPBGS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |