C16H24N4 — CID 114770120
2-[[2-(aminomethyl)cyclohexyl]-ethylamino]-6-methylpyridine-4-carbonitrile (PubChem CID 114770120) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 2-[[2-(aminomethyl)cyclohexyl]-ethylamino]-6-methylpyridine-4-carbonitrile.
| Compound Name | 2-[[2-(aminomethyl)cyclohexyl]-ethylamino]-6-methylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114770120 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2-[[2-(aminomethyl)cyclohexyl]-ethylamino]-6-methylpyridine-4-carbonitrile |
| SMILES | CCN(c1cc(C#N)cc(C)n1)C1CCCCC1CN |
| InChI | InChI=1S/C16H24N4/c1-3-20(15-7-5-4-6-14(15)11-18)16-9-13(10-17)8-12(2)19-16/h8-9,14-15H,3-7,11,18H2,1-2H3 |
| InChIKey | SRYOJODLQLPOEP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |