C14H21N5 — CID 107552593
2-[[2-(aminomethyl)cyclopentyl]-ethylamino]-6-methylpyrimidine-4-carbonitrile (PubChem CID 107552593) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-[[2-(aminomethyl)cyclopentyl]-ethylamino]-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-[[2-(aminomethyl)cyclopentyl]-ethylamino]-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107552593 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2-[[2-(aminomethyl)cyclopentyl]-ethylamino]-6-methylpyrimidine-4-carbonitrile |
| SMILES | CCN(c1nc(C)cc(C#N)n1)C1CCCC1CN |
| InChI | InChI=1S/C14H21N5/c1-3-19(13-6-4-5-11(13)8-15)14-17-10(2)7-12(9-16)18-14/h7,11,13H,3-6,8,15H2,1-2H3 |
| InChIKey | QXVGXBNJKQZPCP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |