C13H15N3 — CID 114766517
2-[cyclopropyl(prop-2-enyl)amino]-6-methylpyridine-4-carbonitrile (PubChem CID 114766517) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[cyclopropyl(prop-2-enyl)amino]-6-methylpyridine-4-carbonitrile.
| Compound Name | 2-[cyclopropyl(prop-2-enyl)amino]-6-methylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114766517 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-[cyclopropyl(prop-2-enyl)amino]-6-methylpyridine-4-carbonitrile |
| SMILES | C=CCN(c1cc(C#N)cc(C)n1)C1CC1 |
| InChI | InChI=1S/C13H15N3/c1-3-6-16(12-4-5-12)13-8-11(9-14)7-10(2)15-13/h3,7-8,12H,1,4-6H2,2H3 |
| InChIKey | DCDUVGUCHTTXNV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|