C9H11N5S — CID 106972702
6-methylsulfanyl-N-(1H-pyrazol-5-ylmethyl)pyrimidin-4-amine (PubChem CID 106972702) has the molecular formula C9H11N5S and a molecular weight of 221.29 g/mol. Its IUPAC name is 6-methylsulfanyl-N-(1H-pyrazol-5-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-methylsulfanyl-N-(1H-pyrazol-5-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106972702 |
| Molecular Formula | C9H11N5S |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 6-methylsulfanyl-N-(1H-pyrazol-5-ylmethyl)pyrimidin-4-amine |
| SMILES | CSc1cc(NCc2ccn[nH]2)ncn1 |
| InChI | InChI=1S/C9H11N5S/c1-15-9-4-8(11-6-12-9)10-5-7-2-3-13-14-7/h2-4,6H,5H2,1H3,(H,13,14)(H,10,11,12) |
| InChIKey | JUEGBBDSPJQKAQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |