C8H9N5 — CID 60966310
N-(1H-pyrazol-5-ylmethyl)pyrazin-2-amine (PubChem CID 60966310) has the molecular formula C8H9N5 and a molecular weight of 175.20 g/mol. Its IUPAC name is N-(1H-pyrazol-5-ylmethyl)pyrazin-2-amine.
| Compound Name | N-(1H-pyrazol-5-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 60966310 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.20 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | N-(1H-pyrazol-5-ylmethyl)pyrazin-2-amine |
| SMILES | c1cnc(NCc2ccn[nH]2)cn1 |
| InChI | InChI=1S/C8H9N5/c1-2-12-13-7(1)5-11-8-6-9-3-4-10-8/h1-4,6H,5H2,(H,10,11)(H,12,13) |
| InChIKey | ZSGFNYDZGSNBQS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |