C8H8N4O — CID 106419182
N-(1,2-oxazol-5-ylmethyl)pyrazin-2-amine (PubChem CID 106419182) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is N-(1,2-oxazol-5-ylmethyl)pyrazin-2-amine.
| Compound Name | N-(1,2-oxazol-5-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 106419182 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | N-(1,2-oxazol-5-ylmethyl)pyrazin-2-amine |
| SMILES | c1cnc(NCc2ccno2)cn1 |
| InChI | InChI=1S/C8H8N4O/c1-2-12-13-7(1)5-11-8-6-9-3-4-10-8/h1-4,6H,5H2,(H,10,11) |
| InChIKey | YJCWHZSACOCKBT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |