C8H9N5O — CID 106424136
3-N-(1,2-oxazol-5-ylmethyl)pyrazine-2,3-diamine (PubChem CID 106424136) has the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. Its IUPAC name is 3-N-(1,2-oxazol-5-ylmethyl)pyrazine-2,3-diamine.
| Compound Name | 3-N-(1,2-oxazol-5-ylmethyl)pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 106424136 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 3-N-(1,2-oxazol-5-ylmethyl)pyrazine-2,3-diamine |
| SMILES | Nc1nccnc1NCc1ccno1 |
| InChI | InChI=1S/C8H9N5O/c9-7-8(11-4-3-10-7)12-5-6-1-2-13-14-6/h1-4H,5H2,(H2,9,10)(H,11,12) |
| InChIKey | OIAWVJQFVLZTRF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |