C8H9N5O2 — CID 136902041
5-amino-4-(1,2-oxazol-5-ylmethylamino)-1H-pyrimidin-6-one (PubChem CID 136902041) has the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. Its IUPAC name is 5-amino-4-(1,2-oxazol-5-ylmethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(1,2-oxazol-5-ylmethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136902041 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 5-amino-4-(1,2-oxazol-5-ylmethylamino)-1H-pyrimidin-6-one |
| SMILES | Nc1c(NCc2ccno2)nc[nH]c1=O |
| InChI | InChI=1S/C8H9N5O2/c9-6-7(11-4-12-8(6)14)10-3-5-1-2-13-15-5/h1-2,4H,3,9H2,(H2,10,11,12,14) |
| InChIKey | UYCRCHPUCHTVBP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |