C9H9IN4 — CID 130643757
5-iodo-N-(1H-pyrazol-5-ylmethyl)pyridin-2-amine (PubChem CID 130643757) has the molecular formula C9H9IN4 and a molecular weight of 300.10 g/mol. Its IUPAC name is 5-iodo-N-(1H-pyrazol-5-ylmethyl)pyridin-2-amine.
| Compound Name | 5-iodo-N-(1H-pyrazol-5-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 130643757 |
| Molecular Formula | C9H9IN4 |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 5-iodo-N-(1H-pyrazol-5-ylmethyl)pyridin-2-amine |
| SMILES | Ic1ccc(NCc2ccn[nH]2)nc1 |
| InChI | InChI=1S/C9H9IN4/c10-7-1-2-9(11-5-7)12-6-8-3-4-13-14-8/h1-5H,6H2,(H,11,12)(H,13,14) |
| InChIKey | NXKXLANTMQJUQR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|