C11H18N4OS — CID 106972987
2-[(6-methylsulfanylpyrimidin-4-yl)amino]-N-propan-2-ylpropanamide (PubChem CID 106972987) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 2-[(6-methylsulfanylpyrimidin-4-yl)amino]-N-propan-2-ylpropanamide.
| Compound Name | 2-[(6-methylsulfanylpyrimidin-4-yl)amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 106972987 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-[(6-methylsulfanylpyrimidin-4-yl)amino]-N-propan-2-ylpropanamide |
| SMILES | CSc1cc(NC(C)C(=O)NC(C)C)ncn1 |
| InChI | InChI=1S/C11H18N4OS/c1-7(2)14-11(16)8(3)15-9-5-10(17-4)13-6-12-9/h5-8H,1-4H3,(H,14,16)(H,12,13,15) |
| InChIKey | XUELWXJAYCPUMV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |