C10H16BrN3S — CID 106973796
N-(4-bromopentan-2-yl)-6-methylsulfanylpyrimidin-4-amine (PubChem CID 106973796) has the molecular formula C10H16BrN3S and a molecular weight of 290.23 g/mol. Its IUPAC name is N-(4-bromopentan-2-yl)-6-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-(4-bromopentan-2-yl)-6-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106973796 |
| Molecular Formula | C10H16BrN3S |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | N-(4-bromopentan-2-yl)-6-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1cc(NC(C)CC(C)Br)ncn1 |
| InChI | InChI=1S/C10H16BrN3S/c1-7(11)4-8(2)14-9-5-10(15-3)13-6-12-9/h5-8H,4H2,1-3H3,(H,12,13,14) |
| InChIKey | VDILTINJEGJTPM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|