C14H25N3O2 — CID 106975460
N-[3-(cyclopropylamino)-3-oxopropyl]-2-propylpyrrolidine-2-carboxamide (PubChem CID 106975460) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is N-[3-(cyclopropylamino)-3-oxopropyl]-2-propylpyrrolidine-2-carboxamide.
| Compound Name | N-[3-(cyclopropylamino)-3-oxopropyl]-2-propylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 106975460 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | N-[3-(cyclopropylamino)-3-oxopropyl]-2-propylpyrrolidine-2-carboxamide |
| SMILES | CCCC1(C(=O)NCCC(=O)NC2CC2)CCCN1 |
| InChI | InChI=1S/C14H25N3O2/c1-2-7-14(8-3-9-16-14)13(19)15-10-6-12(18)17-11-4-5-11/h11,16H,2-10H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | HZGLZFPBSUKAIO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |