C13H22F3NO3 — CID 106978909
2-propyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidine-2-carboxylic acid (PubChem CID 106978909) has the molecular formula C13H22F3NO3 and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-propyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 2-propyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 106978909 |
| Molecular Formula | C13H22F3NO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-propyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCCN1CCCOCC(F)(F)F |
| InChI | InChI=1S/C13H22F3NO3/c1-2-5-12(11(18)19)6-3-7-17(12)8-4-9-20-10-13(14,15)16/h2-10H2,1H3,(H,18,19) |
| InChIKey | QBEXKPPKYNKIRT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|