About 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid
1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid (PubChem CID 172812116) has the molecular formula C11H16F2INO4
and a molecular weight of 391.15 g/mol. Its IUPAC name is 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid |
| PubChem CID | 172812116 |
| Molecular Formula | C11H16F2INO4 |
| Molecular Weight | 391.15 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)N1CC(F)(F)CC1(CCCI)C(=O)O |
| InChI | InChI=1S/C11H16F2INO4/c1-2-19-9(18)15-7-11(12,13)6-10(15,8(16)17)4-3-5-14/h2-7H2,1H3,(H,16,17) |
| InChIKey | SHYDDPLDAAKOIB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid?
The IUPAC name of 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid (CID 172812116) is 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid is CCOC(=O)N1CC(F)(F)CC1(CCCI)C(=O)O.
What is the InChIKey of 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid?
The InChIKey is SHYDDPLDAAKOIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2INO4/c1-2-19-9(18)15-7-11(12,13)6-10(15,8(16)17)4-3-5-14/h2-7H2,1H3,(H,16,17).
What are the key properties of 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid?
1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid has a molecular weight of 391.15 g/mol, XLogP of 2.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxycarbonyl-4,4-difluoro-2-(3-iodopropyl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 172812116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).